Difference between revisions of "PWY-321"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14270 CPD-14270] == * common-name: ** dodecyl icosanoate * smiles: ** cccccccccccccccccccc(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13025 CPD-13025] == * common-name: ** guanosine 2'-monophosphate * smiles: ** c(o)c1(oc(c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13025 CPD-13025] == |
* common-name: | * common-name: | ||
| − | ** | + | ** guanosine 2'-monophosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wtifiazwccbcge-uuokfmhzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 361.207 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12058]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=guanosine 2'-monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wtifiazwccbcge-uuokfmhzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=361.207}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-13025
- common-name:
- guanosine 2'-monophosphate
- smiles:
- c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- wtifiazwccbcge-uuokfmhzsa-l
- molecular-weight:
- 361.207
