Difference between revisions of "PWY-3261"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c...")
(Created page with "Category:pathway == Pathway PWY-3261 == * taxonomic-range: ** tax-4751 ** tax-33090 * common-name: ** udp-β-l-rhamnose biosynthesis == Reaction(s) found == * RXN-10...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
+
== Pathway PWY-3261 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-33090
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** udp-β-l-rhamnose biosynthesis
* smiles:
+
== Reaction(s) found ==
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
* [[RXN-10740]]
* inchi-key:
+
* [[RXN-18332]]
** cipfcgzlfxvxbg-cnwjwelysa-f
+
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 492.013
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-4751|tax-33090}}
* [[RXN-7184]]
+
{{#set: common-name=udp-β-l-rhamnose biosynthesis}}
* [[RXN-8730]]
+
{{#set: nb reaction found=3}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
* [[2.7.1.127-RXN]]
+
{{#set: nb total reaction=3}}
* [[2.7.1.139-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
 
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
 
{{#set: molecular-weight=492.013}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-3261

  • taxonomic-range:
    • tax-4751
    • tax-33090
  • common-name:
    • udp-β-l-rhamnose biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present