Difference between revisions of "PWY-3261"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-2-methyladenine2503 23S-rRNA-2-methyladenine2503] == * common-name: ** a 2-methyladeni...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-2-methyladenine2503 23S-rRNA-2-methyladenine2503] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
 
* common-name:
 
* common-name:
** a 2-methyladenine2503 in 23s rrna
+
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
 +
* smiles:
 +
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 +
* inchi-key:
 +
** cipfcgzlfxvxbg-cnwjwelysa-f
 +
* molecular-weight:
 +
** 492.013
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7184]]
 +
* [[RXN-8730]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11586]]
+
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.139-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-methyladenine2503 in 23s rrna}}
+
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
 +
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
 +
{{#set: molecular-weight=492.013}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-506

  • common-name:
    • d-myo-inositol (1,3,4,5)-tetrakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • cipfcgzlfxvxbg-cnwjwelysa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality