Difference between revisions of "PWY-3301"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13700 CPD-13700] == * common-name: ** 3-oxo-4-pregnene-20-carboxyl-coa * smiles: ** cc(c(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * common-name: ** cyclic-gmp * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13700 CPD-13700] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] ==
 
* common-name:
 
* common-name:
** 3-oxo-4-pregnene-20-carboxyl-coa
+
** cyclic-gmp
 
* smiles:
 
* smiles:
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
+
** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-]))
 
* inchi-key:
 
* inchi-key:
** cjjbducnumwujx-zktjokcmsa-j
+
** zoogrgpoevqqdx-uuokfmhzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 1089.98
+
** 344.2
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12710]]
+
* [[GUANYLCYC-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-4-pregnene-20-carboxyl-coa}}
+
{{#set: common-name=cyclic-gmp}}
{{#set: inchi-key=inchikey=cjjbducnumwujx-zktjokcmsa-j}}
+
{{#set: inchi-key=inchikey=zoogrgpoevqqdx-uuokfmhzsa-m}}
{{#set: molecular-weight=1089.98}}
+
{{#set: molecular-weight=344.2}}

Revision as of 09:22, 27 August 2019

Metabolite CGMP

  • common-name:
    • cyclic-gmp
  • smiles:
    • c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-]))
  • inchi-key:
    • zoogrgpoevqqdx-uuokfmhzsa-m
  • molecular-weight:
    • 344.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality