Difference between revisions of "PWY-3561"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MN+2 MN+2] == * common-name: ** mn2+ * smiles: ** [mn++] * inchi-key: ** waemqwokjmhjla-uhfffao...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] == |
* common-name: | * common-name: | ||
| − | ** | + | ** fmn |
* smiles: | * smiles: | ||
| − | ** [ | + | ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ankzybdxhmzbdk-scrdcrapsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 453.324 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[FAD-PYROPHOSPHATASE-RXN]] |
| − | * [[ | + | * [[FADSYN-RXN]] |
| − | * [[ | + | * [[RXN-9510]] |
| + | * [[RXN0-5187]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARPT]] |
| − | * [[ | + | * [[FAD-PYROPHOSPHATASE-RXN]] |
| − | * [[ | + | * [[RIBOFLAVINKIN-RXN]] |
| + | * [[RXN-9510]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=fmn}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=453.324}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite FMN
- common-name:
- fmn
- smiles:
- cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
- inchi-key:
- ankzybdxhmzbdk-scrdcrapsa-k
- molecular-weight:
- 453.324
