Difference between revisions of "PWY-3641"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+== Pathway PWY-3641 ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** unsaturated gellan tetrasaccharide
+** l-carnitine degradation iii
-* smiles:
+== Reaction(s) found ==
-** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
+* [[1.1.1.39-RXN]]
-* inchi-key:
+* [[RXN-6002]]
-** jmdplhpaglyhci-pqvubfrasa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-5921 RXN-5921]
-** 645.544
+{{#set: taxonomic-range=tax-1224}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-carnitine degradation iii}}
-* [[RXN-12270]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=unsaturated gellan tetrasaccharide}}
-{{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}}
-{{#set: molecular-weight=645.544}}