Difference between revisions of "PWY-3641"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14828 CPD-14828] == * common-name: ** 1-c16:0-α,ω-dicarboxyl-2-lysophosphatidat...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14828 CPD-14828] ==
 
* common-name:
 
* common-name:
** unsaturated gellan tetrasaccharide
+
** 1-c16:0-α,ω-dicarboxyl-2-lysophosphatidate
 
* smiles:
 
* smiles:
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
+
** c(c(o)cop([o-])(=o)[o-])oc(ccccccccccccccc(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** jmdplhpaglyhci-pqvubfrasa-m
+
** lsetuzayschykl-qgzvfwflsa-k
 
* molecular-weight:
 
* molecular-weight:
** 645.544
+
** 437.446
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12270]]
+
* [[RXN-13805]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13805]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=unsaturated gellan tetrasaccharide}}
+
{{#set: common-name=1-c16:0-α,ω-dicarboxyl-2-lysophosphatidate}}
{{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}}
+
{{#set: inchi-key=inchikey=lsetuzayschykl-qgzvfwflsa-k}}
{{#set: molecular-weight=645.544}}
+
{{#set: molecular-weight=437.446}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-14828

  • common-name:
    • 1-c16:0-α,ω-dicarboxyl-2-lysophosphatidate
  • smiles:
    • c(c(o)cop([o-])(=o)[o-])oc(ccccccccccccccc(=o)[o-])=o
  • inchi-key:
    • lsetuzayschykl-qgzvfwflsa-k
  • molecular-weight:
    • 437.446

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality