Difference between revisions of "PWY-3801"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] ==
+== Pathway PWY-3801 ==
+* taxonomic-range:
+** tax-1117
+** tax-33090
 * common-name:
-** icosapentaenoate
+** sucrose degradation ii (sucrose synthase)
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
+* [[FRUCTOKINASE-RXN]]
-* inchi-key:
+* [[GLUC1PURIDYLTRANS-RXN]]
-** jazbehyotptenj-jlnkqsitsa-m
+* [[PGLUCISOM-RXN]]
-* molecular-weight:
+* [[PHOSPHOGLUCMUT-RXN]]
-** 301.448
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneSUCROSE-SYNTHASE-RXN SUCROSE-SYNTHASE-RXN]
-* [[RXN-12978]]
+{{#set: taxonomic-range=tax-1117|tax-33090}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=sucrose degradation ii (sucrose synthase)}}
-* [[RXN-13430]]
+{{#set: nb reaction found=4}}
-* [[RXN-13431]]
+{{#set: completion rate=0.8}}
-* [[RXN-16139]]
+{{#set: nb total reaction=5}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=icosapentaenoate}}
-{{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}}
-{{#set: molecular-weight=301.448}}