Difference between revisions of "PWY-3861"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] ==
+== Pathway PWY-3861 ==
+* taxonomic-range:
+** tax-58023
 * common-name:
-** 4-methylphenyl sulfate
+** mannitol degradation ii
-* smiles:
+== Reaction(s) found ==
-** cc1(c=cc(=cc=1)os(=o)(=o)[o-])
+* [[MANNKIN-RXN]]
-* inchi-key:
+* [[MANNPISOM-RXN]]
-** wgnakzgusrvwrh-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [None1.1.1.255-RXN 1.1.1.255-RXN]
-** 187.19
+* [NoneRXN-14500 RXN-14500]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-58023}}
-* [[RXN-15588]]
+{{#set: common-name=mannitol degradation ii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-15588]]
+{{#set: completion rate=0.5}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=4-methylphenyl sulfate}}
-{{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}}
-{{#set: molecular-weight=187.19}}