Difference between revisions of "PWY-3881"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] ==
+== Pathway PWY-3881 ==
+* taxonomic-range:
+** tax-58023
 * common-name:
-** maltotetraose
+** mannitol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
+* [[MANNITOL-1-PHOSPHATASE-RXN]]
-* inchi-key:
+* [[MANNPISOM-RXN]]
-** luewuzlmquobsb-ayqjavfrsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneMANNOSE-6-PHOSPHATE-6-REDUCTASE-RXN MANNOSE-6-PHOSPHATE-6-REDUCTASE-RXN]
-** 666.583
+{{#set: taxonomic-range=tax-58023}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=mannitol biosynthesis}}
-* [[RXN0-5182]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-* [[GLYMALTOPHOSPHORYL-RXN]]
+{{#set: nb total reaction=3}}
-* [[RXN-14281]]
-* [[RXN-14284]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=maltotetraose}}
-{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
-{{#set: molecular-weight=666.583}}