Difference between revisions of "PWY-40"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] ==
+== Pathway PWY-7082 ==
+* taxonomic-range:
+** tax-914
+** tax-1227
+** tax-35798
 * common-name:
-** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
+** ammonia oxidation iv (autotrophic ammonia oxidizers)
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[1.10.2.2-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** hgvxutaezaltig-hkhrklhhsa-j
+* [NoneRXN-13572 RXN-13572]
-* molecular-weight:
+{{#set: taxonomic-range=tax-914|tax-1227|tax-35798}}
-** 1073.981
+{{#set: common-name=ammonia oxidation iv (autotrophic ammonia oxidizers)}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[RXN-13444]]
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa}}
-{{#set: inchi-key=inchikey=hgvxutaezaltig-hkhrklhhsa-j}}
-{{#set: molecular-weight=1073.981}}