Difference between revisions of "PWY-4041"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-ribosylnicotinate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pueddpcucprqny-zyuzmqfosa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.227 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8443]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14227]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-ribosylnicotinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.227}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-8259
- common-name:
- β-d-ribosylnicotinate
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
- inchi-key:
- pueddpcucprqny-zyuzmqfosa-n
- molecular-weight:
- 255.227
