Difference between revisions of "PWY-4101"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-365 CPD-365] == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myelin-L-arginines Myelin-L-arginines] == * common-name: ** [myelin basic protein]-l-arginine =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-365 CPD-365] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myelin-L-arginines Myelin-L-arginines] ==
 
* common-name:
 
* common-name:
** 1-keto-d-chiro-inositol
+
** [myelin basic protein]-l-arginine
* smiles:
 
** c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
 
* inchi-key:
 
** vyegbdhsghxogt-qfycrykcsa-n
 
* molecular-weight:
 
** 178.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14148]]
+
* [[2.1.1.126-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14148]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-keto-d-chiro-inositol}}
+
{{#set: common-name=[myelin basic protein]-l-arginine}}
{{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}}
 
{{#set: molecular-weight=178.141}}
 

Revision as of 14:18, 26 August 2019

Metabolite Myelin-L-arginines

  • common-name:
    • [myelin basic protein]-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "myelin basic protein]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.