Difference between revisions of "PWY-4202"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * common-name: ** 15,16-dihydrobiliverdin * s...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == * common-name: ** β-d-fructose 1,6-bis...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] ==
 
* common-name:
 
* common-name:
** 15,16-dihydrobiliverdin
+
** β-d-fructose 1,6-bisphosphate
 
* smiles:
 
* smiles:
** c=cc1(=c(c)c(nc1=cc4(=c(c)c(ccc(=o)[o-])=c(c=c2(c(ccc(=o)[o-])=c(c)c(=n2)c[ch]3(c(c)=c(c=c)c(=o)n3)))n4))=o)
+
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** zqhdslzhmauuqk-ztygkhtcsa-l
+
** rnbgygvwrkecfj-arqdhwqxsa-j
 
* molecular-weight:
 
* molecular-weight:
** 582.655
+
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.7.3-RXN]]
+
* [[2.7.1.90-RXN]]
* [[R05818]]
+
* [[F16ALDOLASE-RXN]]
* [[R05819]]
+
* [[F16BDEPHOS-RXN]]
 +
* [[FBA_]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.2-RXN]]
+
* [[2.7.1.90-RXN]]
* [[R05818]]
+
* [[6PFRUCTPHOS-RXN]]
* [[R05819]]
+
* [[F16ALDOLASE-RXN]]
 +
* [[FBA_]]
 +
* [[PFK_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=15,16-dihydrobiliverdin}}
+
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
{{#set: inchi-key=inchikey=zqhdslzhmauuqk-ztygkhtcsa-l}}
+
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
{{#set: molecular-weight=582.655}}
+
{{#set: molecular-weight=336.085}}

Revision as of 14:19, 26 August 2019

Metabolite FRUCTOSE-16-DIPHOSPHATE

  • common-name:
    • β-d-fructose 1,6-bisphosphate
  • smiles:
    • c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
  • inchi-key:
    • rnbgygvwrkecfj-arqdhwqxsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality