Difference between revisions of "PWY-4261"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * common-name: ** 5α-cholestan-3-one * smiles: ** cc(c)cccc(c)[ch]3...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MENADIOL MENADIOL] == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MENADIOL MENADIOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** menadiol |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zjtlzydqjhkrmq-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.199 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[NADH-DEHYDROGENASE-QUINONE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menadiol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zjtlzydqjhkrmq-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.199}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite MENADIOL
- common-name:
- menadiol
- smiles:
- cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2))
- inchi-key:
- zjtlzydqjhkrmq-uhfffaoysa-n
- molecular-weight:
- 174.199
