Difference between revisions of "PWY-4321"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodec-2-enoyl-ACPs Dodec-2-enoyl-ACPs] == * common-name: ** a (2e)-dodec-2-enoyl-[acp] == React...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** urate |
| + | * smiles: | ||
| + | ** c12(nc(=o)nc=1c(=o)nc(=o)n2) | ||
| + | * inchi-key: | ||
| + | ** lehotffkmjeonl-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 168.112 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-901]] |
| − | * [[RXN | + | * [[URATE-OXIDASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[RXN0-901]] |
| + | * [[XANTHINE-OXIDASE-RXN]] | ||
| + | * [[XNDH]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=urate}} |
| + | {{#set: inchi-key=inchikey=lehotffkmjeonl-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=168.112}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite URATE
- common-name:
- urate
- smiles:
- c12(nc(=o)nc=1c(=o)nc(=o)n2)
- inchi-key:
- lehotffkmjeonl-uhfffaoysa-n
- molecular-weight:
- 168.112
