Difference between revisions of "PWY-4321"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key:...") |
(Created page with "Category:pathway == Pathway PWY-6370 == * taxonomic-range: ** tax-7742 * common-name: ** ascorbate recycling (cytosolic) == Reaction(s) found == * 1.6.5.4-RXN * 1.8....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-6370 == |
+ | * taxonomic-range: | ||
+ | ** tax-7742 | ||
* common-name: | * common-name: | ||
− | ** | + | ** ascorbate recycling (cytosolic) |
− | + | == Reaction(s) found == | |
− | + | * [[1.6.5.4-RXN]] | |
− | + | * [[1.8.5.1-RXN]] | |
− | + | == Reaction(s) not found == | |
− | + | * [NoneRXN-3523 RXN-3523] | |
− | + | * [NoneRXN-10981 RXN-10981] | |
− | == Reaction(s) | + | * [NoneRXN-3522 RXN-3522] |
− | * [[ | + | * [NoneRXN-10980 RXN-10980] |
− | * [[ | + | {{#set: taxonomic-range=tax-7742}} |
− | == Reaction(s) | + | {{#set: common-name=ascorbate recycling (cytosolic)}} |
− | * [[ | + | {{#set: nb reaction found=2}} |
− | * [ | + | {{#set: completion rate=0.33}} |
− | * [ | + | {{#set: nb total reaction=6}} |
− | = | ||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Revision as of 20:17, 18 December 2020
Pathway PWY-6370
- taxonomic-range:
- tax-7742
- common-name:
- ascorbate recycling (cytosolic)
Reaction(s) found
Reaction(s) not found
- [NoneRXN-3523 RXN-3523]
- [NoneRXN-10981 RXN-10981]
- [NoneRXN-3522 RXN-3522]
- [NoneRXN-10980 RXN-10980]