Difference between revisions of "PWY-4321"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] ==
+== Pathway PWY-6370 ==
+* taxonomic-range:
+** tax-7742
 * common-name:
-** urate
+** ascorbate recycling (cytosolic)
-* smiles:
+== Reaction(s) found ==
-** c12(nc(=o)nc=1c(=o)nc(=o)n2)
+* [[1.6.5.4-RXN]]
-* inchi-key:
+* [[1.8.5.1-RXN]]
-** lehotffkmjeonl-uhfffaoysa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-3523 RXN-3523]
-** 168.112
+* [NoneRXN-10981 RXN-10981]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-3522 RXN-3522]
-* [[RXN0-901]]
+* [NoneRXN-10980 RXN-10980]
-* [[URATE-OXIDASE-RXN]]
+{{#set: taxonomic-range=tax-7742}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=ascorbate recycling (cytosolic)}}
-* [[RXN0-901]]
+{{#set: nb reaction found=2}}
-* [[XANTHINE-OXIDASE-RXN]]
+{{#set: completion rate=0.33}}
-* [[XNDH]]
+{{#set: nb total reaction=6}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=urate}}
-{{#set: inchi-key=inchikey=lehotffkmjeonl-uhfffaoysa-n}}
-{{#set: molecular-weight=168.112}}