Difference between revisions of "PWY-4341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * common-name: ** avenasterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
 
* common-name:
 
* common-name:
** ctp
+
** avenasterol
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
+
** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** pcdqprrszkqhhs-xvfcmesisa-j
+
** mcwvpsbqqxuctb-oqtioydcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 479.127
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.14-RXN]]
+
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
* [[2.7.7.15-RXN]]
+
* [[RXN-4209]]
* [[2.7.7.60-RXN]]
 
* [[CDPDIGLYSYN-RXN]]
 
* [[CHLPCTDh]]
 
* [[DOLICHOL-KINASE-RXN]]
 
* [[P-PANTOCYSLIG-RXN]]
 
* [[RXN-12195]]
 
* [[RXN-12200]]
 
* [[RXN-12959]]
 
* [[RXN-15091]]
 
* [[RXN-7683]]
 
* [[RXN0-383]]
 
* [[RXN0-5515]]
 
* [[RXN0-723]]
 
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATCD]]
+
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
* [[ATCDm]]
 
* [[CDPKIN-RXN]]
 
* [[CTPSYN-RXN]]
 
* [[RXN-14325]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ctp}}
+
{{#set: common-name=avenasterol}}
{{#set: inchi-key=inchikey=pcdqprrszkqhhs-xvfcmesisa-j}}
+
{{#set: inchi-key=inchikey=mcwvpsbqqxuctb-oqtioydcsa-n}}
{{#set: molecular-weight=479.127}}
+
{{#set: molecular-weight=412.698}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-4125

  • common-name:
    • avenasterol
  • smiles:
    • cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • mcwvpsbqqxuctb-oqtioydcsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality