Difference between revisions of "PWY-4341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
 
(Created page with "Category:pathway == Pathway PWY-4341 == * taxonomic-range: ** tax-33090 ** tax-1117 * common-name: ** l-glutamate biosynthesis v == Reaction(s) found == * GLUTAMATE-SYNT...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] ==
+
== Pathway PWY-4341 ==
 +
* taxonomic-range:
 +
** tax-33090
 +
** tax-1117
 
* common-name:
 
* common-name:
** ctp
+
** l-glutamate biosynthesis v
* smiles:
+
== Reaction(s) found ==
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** pcdqprrszkqhhs-xvfcmesisa-j
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-1117|tax-33090}}
** 479.127
+
{{#set: common-name=l-glutamate biosynthesis v}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[2.7.7.14-RXN]]
+
{{#set: completion rate=1.0}}
* [[2.7.7.15-RXN]]
+
{{#set: nb total reaction=1}}
* [[2.7.7.60-RXN]]
 
* [[CDPDIGLYSYN-RXN]]
 
* [[CHLPCTDh]]
 
* [[DOLICHOL-KINASE-RXN]]
 
* [[P-PANTOCYSLIG-RXN]]
 
* [[RXN-12195]]
 
* [[RXN-12200]]
 
* [[RXN-12959]]
 
* [[RXN-15091]]
 
* [[RXN-7683]]
 
* [[RXN0-383]]
 
* [[RXN0-5515]]
 
* [[RXN0-723]]
 
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
* [[ATCD]]
 
* [[ATCDm]]
 
* [[CDPKIN-RXN]]
 
* [[CTPSYN-RXN]]
 
* [[RXN-14325]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=ctp}}
 
{{#set: inchi-key=inchikey=pcdqprrszkqhhs-xvfcmesisa-j}}
 
{{#set: molecular-weight=479.127}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-4341

  • taxonomic-range:
    • tax-33090
    • tax-1117
  • common-name:
    • l-glutamate biosynthesis v

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present