Difference between revisions of "PWY-4381"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key:...") |
(Created page with "Category:pathway == Pathway PWY-4381 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** fatty acid biosynthesis initiation i == Reaction(s) found == * 2.3.1.18...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-4381 == |
+ | * taxonomic-range: | ||
+ | ** tax-2759 | ||
+ | ** tax-2 | ||
* common-name: | * common-name: | ||
− | ** | + | ** fatty acid biosynthesis initiation i |
− | + | == Reaction(s) found == | |
− | + | * [[2.3.1.180-RXN]] | |
− | + | * [[MALONYL-COA-ACP-TRANSACYL-RXN]] | |
− | + | * [[RXN0-5055]] | |
− | + | == Reaction(s) not found == | |
− | + | All reactions of this pathways are in present | |
− | == Reaction(s) | + | {{#set: taxonomic-range=tax-2|tax-2759}} |
− | * [[ | + | {{#set: common-name=fatty acid biosynthesis initiation i}} |
− | * [[ | + | {{#set: nb reaction found=3}} |
− | * [[ | + | {{#set: completion rate=1.0}} |
− | == Reaction(s) | + | {{#set: nb total reaction=3}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Revision as of 20:16, 18 December 2020
Pathway PWY-4381
- taxonomic-range:
- tax-2759
- tax-2
- common-name:
- fatty acid biosynthesis initiation i
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present