Difference between revisions of "PWY-4381"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACYL-GPE 2-ACYL-GPE] == * common-name: ** a 2-acyl-1-lyso-phosphatidylethanolamine == Reactio...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACYL-GPE 2-ACYL-GPE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] ==
 
* common-name:
 
* common-name:
** a 2-acyl-1-lyso-phosphatidylethanolamine
+
** l-asparagine
 +
* smiles:
 +
** c(cc(c(=o)[o-])[n+])(n)=o
 +
* inchi-key:
 +
** dcxyfedjocdnaf-reohclbhsa-n
 +
* molecular-weight:
 +
** 132.119
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ASPARAGHYD-RXN]]
 +
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6952]]
+
* [[ASNSYNA-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[RXN-12460]]
 +
* [[RXN0-6982]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-acyl-1-lyso-phosphatidylethanolamine}}
+
{{#set: common-name=l-asparagine}}
 +
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
 +
{{#set: molecular-weight=132.119}}

Revision as of 09:22, 27 August 2019

Metabolite ASN

  • common-name:
    • l-asparagine
  • smiles:
    • c(cc(c(=o)[o-])[n+])(n)=o
  • inchi-key:
    • dcxyfedjocdnaf-reohclbhsa-n
  • molecular-weight:
    • 132.119

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality