Difference between revisions of "PWY-4621"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2338 CPD0-2338] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] ==
 * common-name:
-** (z)-3-ureidoacrylate peracid
+** l-tryptophan
 * smiles:
-** c(nc(n)=o)=cc(=o)oo
+** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
 * inchi-key:
-** ajfkxwqdhfykfk-uphrsurjsa-n
+** qivbcdijiajpqs-vifpvbqesa-n
 * molecular-weight:
-** 146.102
+** 204.228
 == Reaction(s) known to consume the compound ==
-* [[RXN-12894]]
+* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
-* [[RXN0-6460]]
+* [[RXN-8665]]
+* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
+* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
+* [[RXN0-2382]]
+* [[TRYPSYN-RXN]]
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(z)-3-ureidoacrylate peracid}}
+{{#set: common-name=l-tryptophan}}
-{{#set: inchi-key=inchikey=ajfkxwqdhfykfk-uphrsurjsa-n}}
+{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
-{{#set: molecular-weight=146.102}}
+{{#set: molecular-weight=204.228}}