Difference between revisions of "PWY-4661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS] == * common-name: ** pro...")
 
(Created page with "Category:pathway == Pathway PWY-4661 == * taxonomic-range: ** tax-33090 * common-name: ** 1d-myo-inositol hexakisphosphate biosynthesis iii (spirodela polyrrhiza) == React...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS] ==
+
== Pathway PWY-4661 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** prostaglandin e2
+
** 1d-myo-inositol hexakisphosphate biosynthesis iii (spirodela polyrrhiza)
* smiles:
+
== Reaction(s) found ==
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
+
* [[2.7.1.134-RXN]]
* inchi-key:
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
** xeybrnlfezdvaw-arsrfyassa-m
+
* [[RXN-7163]]
* molecular-weight:
+
== Reaction(s) not found ==
** 351.462
+
* [NoneRXN-7204 RXN-7204]
== Reaction(s) known to consume the compound ==
+
* [NoneMYO-INOSITOL-1-KINASE-RXN MYO-INOSITOL-1-KINASE-RXN]
* [[1.1.1.141-RXN]]
+
* [NoneRXN-7203 RXN-7203]
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+
* [NoneRXN-7202 RXN-7202]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-33090}}
* [[1.1.1.141-RXN]]
+
{{#set: common-name=1d-myo-inositol hexakisphosphate biosynthesis iii (spirodela polyrrhiza)}}
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
+
{{#set: nb reaction found=3}}
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+
{{#set: completion rate=0.43}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=7}}
{{#set: common-name=prostaglandin e2}}
 
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
 
{{#set: molecular-weight=351.462}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-4661

  • taxonomic-range:
    • tax-33090
  • common-name:
    • 1d-myo-inositol hexakisphosphate biosynthesis iii (spirodela polyrrhiza)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7204 RXN-7204]
  • [NoneMYO-INOSITOL-1-KINASE-RXN MYO-INOSITOL-1-KINASE-RXN]
  • [NoneRXN-7203 RXN-7203]
  • [NoneRXN-7202 RXN-7202]