Difference between revisions of "PWY-4661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS] == * common-name: ** pro...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * common-name: ** l-gulono-1,4-lactone * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] ==
 
* common-name:
 
* common-name:
** prostaglandin e2
+
** l-gulono-1,4-lactone
 
* smiles:
 
* smiles:
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
+
** c(c([ch]1(c(c(c(o1)=o)o)o))o)o
 
* inchi-key:
 
* inchi-key:
** xeybrnlfezdvaw-arsrfyassa-m
+
** sxzycxmupbbulw-sknvomklsa-n
 
* molecular-weight:
 
* molecular-weight:
** 351.462
+
** 178.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.141-RXN]]
+
* [[L-GULONOLACTONE-OXIDASE-RXN]]
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+
* [[RXN-13689]]
 +
* [[RXN-8783]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.141-RXN]]
 
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
 
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prostaglandin e2}}
+
{{#set: common-name=l-gulono-1,4-lactone}}
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
+
{{#set: inchi-key=inchikey=sxzycxmupbbulw-sknvomklsa-n}}
{{#set: molecular-weight=351.462}}
+
{{#set: molecular-weight=178.141}}

Revision as of 14:19, 26 August 2019

Metabolite L-GULONO-1-4-LACTONE

  • common-name:
    • l-gulono-1,4-lactone
  • smiles:
    • c(c([ch]1(c(c(c(o1)=o)o)o))o)o
  • inchi-key:
    • sxzycxmupbbulw-sknvomklsa-n
  • molecular-weight:
    • 178.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality