Difference between revisions of "PWY-4821"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K+ K+] == * common-name: ** k+ * smiles: ** [k+] * inchi-key: ** npypahlbtdxsss-uhfffaoysa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K+ K+] ==
 
* common-name:
 
* common-name:
** trans-dienelactone
+
** k+
 
* smiles:
 
* smiles:
** c1(=cc(=o)oc(=cc(=o)[o-])1)
+
** [k+]
 
* inchi-key:
 
* inchi-key:
** ayfxpgxazmfwnh-onegzznksa-m
+
** npypahlbtdxsss-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 139.087
+
** 39.098
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9868]]
+
* [[3.6.3.12-RXN]]
 +
* [[3.6.3.9-RXN]]
 +
* [[ExchangeSeed-K+]]
 +
* [[TRANS-RXN-2]]
 +
* [[TransportSeed-K+]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.6.3.12-RXN]]
 +
* [[3.6.3.9-RXN]]
 +
* [[ExchangeSeed-K+]]
 +
* [[TRANS-RXN-2]]
 +
* [[TransportSeed-K+]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-dienelactone}}
+
{{#set: common-name=k+}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
+
{{#set: inchi-key=inchikey=npypahlbtdxsss-uhfffaoysa-n}}
{{#set: molecular-weight=139.087}}
+
{{#set: molecular-weight=39.098}}

Revision as of 09:22, 27 August 2019

Metabolite K+

  • common-name:
    • k+
  • smiles:
    • [k+]
  • inchi-key:
    • npypahlbtdxsss-uhfffaoysa-n
  • molecular-weight:
    • 39.098

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality