Difference between revisions of "PWY-4841"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] ==
+== Pathway PWY-4841 ==
+* taxonomic-range:
+** tax-3193
 * common-name:
-** s-adenosyl 3-(methylthio)propylamine
+** udp-&alpha;-d-glucuronate biosynthesis (from myo-inositol)
-* smiles:
+== Reaction(s) found ==
-** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+* [[2.7.7.44-RXN]]
-* inchi-key:
+* [[MYO-INOSITOL-OXYGENASE-RXN]]
-** zunbitixdcpnsd-lsrjevitsa-o
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneGLUCURONOKINASE-RXN GLUCURONOKINASE-RXN]
-** 356.442
+* [NoneRXN-14693 RXN-14693]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3193}}
-* [[APAPT]]
+{{#set: common-name=udp-&alpha;-d-glucuronate biosynthesis (from myo-inositol)}}
-* [[RXN-11190]]
+{{#set: nb reaction found=2}}
-* [[RXN0-5217]]
+{{#set: completion rate=0.5}}
-* [[SPERMIDINESYN-RXN]]
+{{#set: nb total reaction=4}}
-* [[SPERMINE-SYNTHASE-RXN]]
-== Reaction(s) known to produce the compound ==
-* [[AMCL]]
-* [[RXN-11190]]
-* [[SAMDECARB-RXN]]
-* [[SPERMIDINESYN-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
-{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
-{{#set: molecular-weight=356.442}}