Difference between revisions of "PWY-4983"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-309 CPD-309] == * common-name: ** d-octopine * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccn...")
(Created page with "Category:pathway == Pathway PWY-4983 == * taxonomic-range: ** tax-33208 * common-name: ** nitric oxide biosynthesis ii (mammals) == Reaction(s) found == * ARGSUCCINLYA-R...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-309 CPD-309] ==
+
== Pathway PWY-4983 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** d-octopine
+
** nitric oxide biosynthesis ii (mammals)
* smiles:
+
== Reaction(s) found ==
** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+]
+
* [[ARGSUCCINLYA-RXN]]
* inchi-key:
+
* [[ARGSUCCINSYN-RXN]]
** imxsccduafeioe-ritpcoansa-n
+
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 246.266
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33208}}
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
+
{{#set: common-name=nitric oxide biosynthesis ii (mammals)}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
* [[1.5.1.11-RXN]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=d-octopine}}
 
{{#set: inchi-key=inchikey=imxsccduafeioe-ritpcoansa-n}}
 
{{#set: molecular-weight=246.266}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-4983

  • taxonomic-range:
    • tax-33208
  • common-name:
    • nitric oxide biosynthesis ii (mammals)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present