Difference between revisions of "PWY-4983"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13406 CPD-13406] == * common-name: ** glycyl-l-aspartate * smiles: ** c([n+])c(=o)nc(cc(=o)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-309 CPD-309] == * common-name: ** d-octopine * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-309 CPD-309] == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-octopine |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** imxsccduafeioe-ritpcoansa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 246.266 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[D-OCTOPINE-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.5.1.11-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-octopine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=imxsccduafeioe-ritpcoansa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=246.266}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-309
- common-name:
- d-octopine
- smiles:
- cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+]
- inchi-key:
- imxsccduafeioe-ritpcoansa-n
- molecular-weight:
- 246.266
