Difference between revisions of "PWY-4983"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-309 CPD-309] ==
+== Pathway PWY-6611 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** d-octopine
+** adenine and adenosine salvage v
-* smiles:
+== Reaction(s) found ==
-** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+]
+* [[ADENODEAMIN-RXN]]
-* inchi-key:
+* [[ADENPHOSPHOR-RXN]]
-** imxsccduafeioe-ritpcoansa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneINOSINEKIN-RXN INOSINEKIN-RXN]
-** 246.266
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=adenine and adenosine salvage v}}
-* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-* [[1.5.1.11-RXN]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=d-octopine}}
-{{#set: inchi-key=inchikey=imxsccduafeioe-ritpcoansa-n}}
-{{#set: molecular-weight=246.266}}