Difference between revisions of "PWY-5025"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1...")
 
(Created page with "Category:pathway == Pathway PWY-5025 == * taxonomic-range: ** tax-1224 * common-name: ** indole-3-acetate biosynthesis iv (bacteria) == Reaction(s) found == * RXNN-404...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] ==
+
== Pathway PWY-5025 ==
 +
* taxonomic-range:
 +
** tax-1224
 
* common-name:
 
* common-name:
** ribose-1-arsenate
+
** indole-3-acetate biosynthesis iv (bacteria)
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
+
* [[RXNN-404]]
* inchi-key:
+
== Reaction(s) not found ==
** ryjjomqpaaufbf-txicztdvsa-l
+
* [NoneRXN-7567 RXN-7567]
* molecular-weight:
+
{{#set: taxonomic-range=tax-1224}}
** 272.043
+
{{#set: common-name=indole-3-acetate biosynthesis iv (bacteria)}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.5}}
* [[RXN-7001]]
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=ribose-1-arsenate}}
 
{{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}}
 
{{#set: molecular-weight=272.043}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-5025

  • taxonomic-range:
    • tax-1224
  • common-name:
    • indole-3-acetate biosynthesis iv (bacteria)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7567 RXN-7567]