Difference between revisions of "PWY-5026"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPALMITOYL-COA 3-OXOPALMITOYL-COA] == * common-name: ** 3-oxo-palmitoyl-coa * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPALMITOYL-COA 3-OXOPALMITOYL-COA] ==
 
* common-name:
 
* common-name:
** (2r,3s,4s)-leucocyanidin
+
** 3-oxo-palmitoyl-coa
 
* smiles:
 
* smiles:
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
+
** cccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** sbzwtshafilote-souvjxgzsa-n
+
** nqmplxpcrjoshl-bbecnahfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 306.271
+
** 1015.898
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-602]]
+
* [[ACACT7]]
 +
* [[HACD7h]]
 +
* [[RXN-14271]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-600]]
+
* [[ACACT7]]
 +
* [[ACACT7h]]
 +
* [[ACACT7m]]
 +
* [[HACD7h]]
 +
* [[RXN-14271]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s,4s)-leucocyanidin}}
+
{{#set: common-name=3-oxo-palmitoyl-coa}}
{{#set: inchi-key=inchikey=sbzwtshafilote-souvjxgzsa-n}}
+
{{#set: inchi-key=inchikey=nqmplxpcrjoshl-bbecnahfsa-j}}
{{#set: molecular-weight=306.271}}
+
{{#set: molecular-weight=1015.898}}

Revision as of 09:22, 27 August 2019

Metabolite 3-OXOPALMITOYL-COA

  • common-name:
    • 3-oxo-palmitoyl-coa
  • smiles:
    • cccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • nqmplxpcrjoshl-bbecnahfsa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality