Difference between revisions of "PWY-5034"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == * common-name: ** 2'-deoxyinosine * smiles: ** c(o)c1(oc(cc(o)1)n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14757 CPD-14757] == * common-name: ** methylphenylsulfide * smiles: ** csc1(=cc=cc=c1) * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14757 CPD-14757] ==
 
* common-name:
 
* common-name:
** 2'-deoxyinosine
+
** methylphenylsulfide
 
* smiles:
 
* smiles:
** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23)))
+
** csc1(=cc=cc=c1)
 
* inchi-key:
 
* inchi-key:
** vgontnsxdcqugy-rrkcrqdmsa-n
+
** hnkjadcvzubcpg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 252.229
+
** 124.2
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DEOXYINOPHOSPHOR-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADDALT-RXN]]
+
* [[RXN-13726]]
* [[DEOXYINOPHOSPHOR-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxyinosine}}
+
{{#set: common-name=methylphenylsulfide}}
{{#set: inchi-key=inchikey=vgontnsxdcqugy-rrkcrqdmsa-n}}
+
{{#set: inchi-key=inchikey=hnkjadcvzubcpg-uhfffaoysa-n}}
{{#set: molecular-weight=252.229}}
+
{{#set: molecular-weight=124.2}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-14757

  • common-name:
    • methylphenylsulfide
  • smiles:
    • csc1(=cc=cc=c1)
  • inchi-key:
    • hnkjadcvzubcpg-uhfffaoysa-n
  • molecular-weight:
    • 124.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality