Difference between revisions of "PWY-5047"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o...")
(Created page with "Category:pathway == Pathway PWY-5047 == * taxonomic-range: ** tax-4751 * common-name: ** gibberellin biosynthesis iv (gibberella fujikuroi) == Reaction(s) found == * 1.1...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] ==
+
== Pathway PWY-5047 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** udp-α-d-glucose
+
** gibberellin biosynthesis iv (gibberella fujikuroi)
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
* [[1.14.13.78-RXN]]
* inchi-key:
+
* [[1.14.13.79-RXN]]
** hscjrczfdfqwrp-jzmiexbbsa-l
+
* [[RXN-5242]]
* molecular-weight:
+
* [[RXN-7580]]
** 564.289
+
* [[RXN1F-160]]
== Reaction(s) known to consume the compound ==
+
* [[RXN1F-161]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) not found ==
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
* [NoneRXN-6545 RXN-6545]
* [[2.4.1.117-RXN]]
+
* [NoneRXN-7619 RXN-7619]
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
+
* [NoneRXN-7621 RXN-7621]
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [NoneRXN-6549 RXN-6549]
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [NoneRXN1F-166 RXN1F-166]
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
+
* [NoneRXN-7624 RXN-7624]
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
+
* [NoneRXN-7634 RXN-7634]
* [[RXN-12123]]
+
* [NoneRXN-7617 RXN-7617]
* [[RXN-12125]]
+
* [NoneRXN-7625 RXN-7625]
* [[RXN-12126]]
+
{{#set: taxonomic-range=tax-4751}}
* [[RXN-12127]]
+
{{#set: common-name=gibberellin biosynthesis iv (gibberella fujikuroi)}}
* [[RXN-12128]]
+
{{#set: nb reaction found=6}}
* [[RXN-1223]]
+
{{#set: completion rate=0.4}}
* [[RXN-15117]]
+
{{#set: nb total reaction=15}}
* [[RXN-16975]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-5482]]
 
* [[RXN-7667]]
 
* [[RXN-7828]]
 
* [[RXN-8228]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG4E]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG1PUT]]
 
* [[UG4E]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=udp-&alpha;-d-glucose}}
 
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
 
{{#set: molecular-weight=564.289}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5047

  • taxonomic-range:
    • tax-4751
  • common-name:
    • gibberellin biosynthesis iv (gibberella fujikuroi)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-6545 RXN-6545]
  • [NoneRXN-7619 RXN-7619]
  • [NoneRXN-7621 RXN-7621]
  • [NoneRXN-6549 RXN-6549]
  • [NoneRXN1F-166 RXN1F-166]
  • [NoneRXN-7624 RXN-7624]
  • [NoneRXN-7634 RXN-7634]
  • [NoneRXN-7617 RXN-7617]
  • [NoneRXN-7625 RXN-7625]