Difference between revisions of "PWY-5047"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o...")
(Created page with "Category:pathway == Pathway PWY-7089 == * taxonomic-range: ** tax-58024 * common-name: ** taxiphyllin bioactivation == Reaction(s) found == * RXN-13600 == Reaction(s)...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] ==
+
== Pathway PWY-7089 ==
 +
* taxonomic-range:
 +
** tax-58024
 
* common-name:
 
* common-name:
** udp-α-d-glucose
+
** taxiphyllin bioactivation
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
* [[RXN-13600]]
* inchi-key:
+
== Reaction(s) not found ==
** hscjrczfdfqwrp-jzmiexbbsa-l
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-58024}}
** 564.289
+
{{#set: common-name=taxiphyllin bioactivation}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
{{#set: completion rate=1.0}}
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
{{#set: nb total reaction=1}}
* [[2.4.1.117-RXN]]
 
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-12123]]
 
* [[RXN-12125]]
 
* [[RXN-12126]]
 
* [[RXN-12127]]
 
* [[RXN-12128]]
 
* [[RXN-1223]]
 
* [[RXN-15117]]
 
* [[RXN-16975]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-5482]]
 
* [[RXN-7667]]
 
* [[RXN-7828]]
 
* [[RXN-8228]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG4E]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG1PUT]]
 
* [[UG4E]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=udp-&alpha;-d-glucose}}
 
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
 
{{#set: molecular-weight=564.289}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-7089

  • taxonomic-range:
    • tax-58024
  • common-name:
    • taxiphyllin bioactivation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present