Difference between revisions of "PWY-5055"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-5-enoyl-CoA cis-5-enoyl-CoA] == * common-name: ** a (5z)-alkan-5-enoyl-coa == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1,7-dimethylurate |
| + | * smiles: | ||
| + | ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) | ||
| + | * inchi-key: | ||
| + | ** nofnclgcujjpku-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 196.165 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11520]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1,7-dimethylurate}} |
| + | {{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=196.165}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-12483
- common-name:
- 1,7-dimethylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
- inchi-key:
- nofnclgcujjpku-uhfffaoysa-n
- molecular-weight:
- 196.165
