Difference between revisions of "PWY-5057"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1] ==
+== Pathway PWY-5057 ==
+* taxonomic-range:
+** tax-2
+** tax-4751
 * common-name:
-** (13e)-11-&alpha;-hydroxy-9,15-dioxoprost-13-enoate
+** l-valine degradation ii
-* smiles:
+== Reaction(s) found ==
-** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
+* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
-* inchi-key:
+* [[RXN-7657]]
-** vxpbdcbtmskckz-xqhnhvhjsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-7643 RXN-7643]
-** 351.462
+{{#set: taxonomic-range=tax-4751|tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-valine degradation ii}}
-* [[1.1.1.197-RXN]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-* [[1.1.1.197-RXN]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(13e)-11-&alpha;-hydroxy-9,15-dioxoprost-13-enoate}}
-{{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}}
-{{#set: molecular-weight=351.462}}