Difference between revisions of "PWY-5057"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14404 CPD-14404] == * common-name: ** 3-oxo-dihomo γ-linolenoyl-coa * smiles: ** cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine1575-in-18StRNAs Guanine1575-in-18StRNAs] == * common-name: ** a guanine1575 in 18s trna...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14404 CPD-14404] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine1575-in-18StRNAs Guanine1575-in-18StRNAs] ==
 
* common-name:
 
* common-name:
** 3-oxo-dihomo γ-linolenoyl-coa
+
** a guanine1575 in 18s trna
* smiles:
 
** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** djfxnrbquufios-ddquopdjsa-j
 
* molecular-weight:
 
** 1065.958
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12968]]
+
* [[RXN-15842]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12777]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=a guanine1575 in 18s trna}}
{{#set: inchi-key=inchikey=djfxnrbquufios-ddquopdjsa-j}}
 
{{#set: molecular-weight=1065.958}}
 

Revision as of 09:22, 27 August 2019

Metabolite Guanine1575-in-18StRNAs

  • common-name:
    • a guanine1575 in 18s trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality