Difference between revisions of "PWY-5059"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * common-name: ** 4-hydroxy-l-threonine * smiles: ** c(o)c(o)c([n+])c(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * common-name: ** isochorismate * smiles: ** c=c(c(=o)[o-])oc1(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** isochorismate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ntgwprccoqcmge-yumqzzprsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 224.17 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.5.1.64-RXN]] | ||
| + | * [[ISOCHORSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ISOCHORSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=isochorismate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ntgwprccoqcmge-yumqzzprsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.17}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite ISOCHORISMATE
- common-name:
- isochorismate
- smiles:
- c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)
- inchi-key:
- ntgwprccoqcmge-yumqzzprsa-l
- molecular-weight:
- 224.17
