Difference between revisions of "PWY-5059"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * common-name: ** isochorismate * smiles: ** c=c(c(=o)[o-])oc1(...")
(Created page with "Category:pathway == Pathway PWY-5059 == * taxonomic-range: ** tax-58024 * common-name: ** pinobanksin biosynthesis == Reaction(s) found == * RXN-7645 * RXN-7647 *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] ==
+
== Pathway PWY-5059 ==
 +
* taxonomic-range:
 +
** tax-58024
 
* common-name:
 
* common-name:
** isochorismate
+
** pinobanksin biosynthesis
* smiles:
+
== Reaction(s) found ==
** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)
+
* [[RXN-7645]]
* inchi-key:
+
* [[RXN-7647]]
** ntgwprccoqcmge-yumqzzprsa-l
+
* [[RXN-7648]]
* molecular-weight:
+
== Reaction(s) not found ==
** 224.17
+
* [NoneRXN-20996 RXN-20996]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-7689 RXN-7689]
* [[2.5.1.64-RXN]]
+
* [NoneRXN-20997 RXN-20997]
* [[ISOCHORSYN-RXN]]
+
{{#set: taxonomic-range=tax-58024}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=pinobanksin biosynthesis}}
* [[ISOCHORSYN-RXN]]
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.6}}
{{#set: common-name=isochorismate}}
+
{{#set: nb total reaction=5}}
{{#set: inchi-key=inchikey=ntgwprccoqcmge-yumqzzprsa-l}}
 
{{#set: molecular-weight=224.17}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5059

  • taxonomic-range:
    • tax-58024
  • common-name:
    • pinobanksin biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-20996 RXN-20996]
  • [NoneRXN-7689 RXN-7689]
  • [NoneRXN-20997 RXN-20997]