Difference between revisions of "PWY-5060"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] ==
+== Pathway PWY-5060 ==
+* taxonomic-range:
+** tax-3398
 * common-name:
-** 2'-deoxyuridine
+** luteolin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
+* [[RXN-7651]]
-* inchi-key:
+== Reaction(s) not found ==
-** mxhrcpnrjammim-shyzeuofsa-n
+* [NoneRXN-7686 RXN-7686]
-* molecular-weight:
+* [NoneRXN-7653 RXN-7653]
-** 228.204
+* [NoneRXN-7652 RXN-7652]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-7687 RXN-7687]
-* [[URA-PHOSPH-RXN]]
+* [NoneRXN-7650 RXN-7650]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN66-587 RXN66-587]
-* [[CYTIDEAM-RXN]]
+{{#set: taxonomic-range=tax-3398}}
-* [[RXN-14143]]
+{{#set: common-name=luteolin biosynthesis}}
-* [[URA-PHOSPH-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.17}}
-{{#set: common-name=2'-deoxyuridine}}
+{{#set: nb total reaction=6}}
-{{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}}
-{{#set: molecular-weight=228.204}}