Difference between revisions of "PWY-5060"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] ==
+== Pathway PWY-6343 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** demethylmenaquinol-9
+** ferulate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+* [[6.2.1.34-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** wjuvwmhfghnqjz-rnfptggasa-n
+* [None4.2.1.101-RXN 4.2.1.101-RXN]
-* molecular-weight:
+* [None4.1.2.41-RXN 4.1.2.41-RXN]
-** 773.236
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=ferulate degradation}}
-* [[RXN-9205]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=demethylmenaquinol-9}}
-{{#set: inchi-key=inchikey=wjuvwmhfghnqjz-rnfptggasa-n}}
-{{#set: molecular-weight=773.236}}