Difference between revisions of "PWY-5068"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1...")
 
(Created page with "Category:pathway == Pathway PWY-5068 == * taxonomic-range: ** tax-1117 ** tax-33682 ** tax-33090 * common-name: ** chlorophyll cycle == Reaction(s) found == * RXN-7674...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] ==
+
== Pathway PWY-5068 ==
 +
* taxonomic-range:
 +
** tax-1117
 +
** tax-33682
 +
** tax-33090
 
* common-name:
 
* common-name:
** 3-keto-β-d-galactose
+
** chlorophyll cycle
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(c(c(c1o)=o)o)o)
+
* [[RXN-7674]]
* inchi-key:
+
* [[RXN-7676]]
** apiqnbnbiiccon-fkmsrsahsa-n
+
* [[RXN-7677]]
* molecular-weight:
+
* [[RXN1F-66]]
** 178.141
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-7679 RXN-7679]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-7678 RXN-7678]
* [[KETOLACTOSE-RXN]]
+
* [NoneRXN-18400 RXN-18400]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-33682|tax-1117|tax-33090}}
{{#set: common-name=3-keto-β-d-galactose}}
+
{{#set: common-name=chlorophyll cycle}}
{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}
+
{{#set: nb reaction found=4}}
{{#set: molecular-weight=178.141}}
+
{{#set: completion rate=0.57}}
 +
{{#set: nb total reaction=7}}

Latest revision as of 10:57, 18 March 2021

Pathway PWY-5068

  • taxonomic-range:
    • tax-1117
    • tax-33682
    • tax-33090
  • common-name:
    • chlorophyll cycle

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7679 RXN-7679]
  • [NoneRXN-7678 RXN-7678]
  • [NoneRXN-18400 RXN-18400]