Difference between revisions of "PWY-5078"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] == * common-name: ** 3-oxo-icosatetraenoyl-coa * smiles: ** ccc=ccc=ccc=cc...")
(Created page with "Category:pathway == Pathway PWY-5078 == * taxonomic-range: ** tax-4751 * common-name: ** l-isoleucine degradation ii == Reaction(s) found == * BRANCHED-CHAINAMINOTRANSFE...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] ==
+
== Pathway PWY-5078 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** 3-oxo-icosatetraenoyl-coa
+
** l-isoleucine degradation ii
* smiles:
+
== Reaction(s) found ==
** ccc=ccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
* inchi-key:
+
* [[RXN-7694]]
** vvlbcjhqulsxjn-qwoxclfssa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
* [None4.1.1.72-RXN 4.1.1.72-RXN]
** 1063.942
+
{{#set: taxonomic-range=tax-4751}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-isoleucine degradation ii}}
* [[RXN-16020]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.67}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=3-oxo-icosatetraenoyl-coa}}
 
{{#set: inchi-key=inchikey=vvlbcjhqulsxjn-qwoxclfssa-j}}
 
{{#set: molecular-weight=1063.942}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5078

  • taxonomic-range:
    • tax-4751
  • common-name:
    • l-isoleucine degradation ii

Reaction(s) found

Reaction(s) not found

  • [None4.1.1.72-RXN 4.1.1.72-RXN]