Difference between revisions of "PWY-5078"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] ==
+== Pathway PWY-5078 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+** l-isoleucine degradation ii
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
+* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
-* inchi-key:
+* [[RXN-7694]]
-** flybtlrocqbhmr-kfsstaeesa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [None4.1.1.72-RXN 4.1.1.72-RXN]
-** 697.095
+{{#set: taxonomic-range=tax-4751}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-isoleucine degradation ii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-14177]]
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
-{{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}}
-{{#set: molecular-weight=697.095}}