Difference between revisions of "PWY-5079"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOVALERYL-COA ISOVALERYL-COA] ==
+== Pathway PWY-5079 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** isovaleryl-coa
+** l-phenylalanine degradation iii
-* smiles:
+== Reaction(s) found ==
-** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+* [[PHEAMINOTRANS-RXN]]
-* inchi-key:
+* [[RXN-7700]]
-** uyvziwwbjmyrcd-zmhdxicwsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NonePHENYLPYRUVATE-DECARBOXYLASE-RXN PHENYLPYRUVATE-DECARBOXYLASE-RXN]
-** 847.62
+* [None2.6.1.58-RXN 2.6.1.58-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-10814 RXN-10814]
-* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
+{{#set: taxonomic-range=tax-4751}}
-* [[IVCDH]]
+{{#set: common-name=l-phenylalanine degradation iii}}
-* [[RXN-14264]]
+{{#set: nb reaction found=2}}
-* [[RXN0-2301]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=4}}
-* [[RXN-14264]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=isovaleryl-coa}}
-{{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}}
-{{#set: molecular-weight=847.62}}