Difference between revisions of "PWY-5082"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9100 CPD-9100] ==
+== Pathway PWY-5082 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** tetrahydrogeranylgeranyl bacteriopheophytin
+** l-methionine degradation iii
-* smiles:
+== Reaction(s) found ==
-** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+* [[RXN-7706]]
-* inchi-key:
+== Reaction(s) not found ==
-** zodfiocmoawrmb-zasykxldsa-n
+* [NoneRXN-7708 RXN-7708]
-* molecular-weight:
+* [NoneRXN-7704 RXN-7704]
-** 886.205
+{{#set: taxonomic-range=tax-4751}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-methionine degradation iii}}
-* [[RXN-8796]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[RXN-8795]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=tetrahydrogeranylgeranyl bacteriopheophytin}}
-{{#set: inchi-key=inchikey=zodfiocmoawrmb-zasykxldsa-n}}
-{{#set: molecular-weight=886.205}}