Difference between revisions of "PWY-5084"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] == * common-name: ** (+)-dihydrokaempferol * smi...")
(Created page with "Category:pathway == Pathway PWY-5290 == * taxonomic-range: ** tax-24966 ** tax-26468 ** tax-4056 * common-name: ** secologanin and strictosidine biosynthesis == Reaction(s...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] ==
+
== Pathway PWY-5290 ==
 +
* taxonomic-range:
 +
** tax-24966
 +
** tax-26468
 +
** tax-4056
 
* common-name:
 
* common-name:
** (+)-dihydrokaempferol
+
** secologanin and strictosidine biosynthesis
* smiles:
+
== Reaction(s) found ==
** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
+
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
* inchi-key:
+
* [[STRICTOSIDINE-SYNTHASE-RXN]]
** padqinqhpqkxnl-lsdhhaiusa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-8618 RXN-8618]
** 288.256
+
* [NoneRXN-9371 RXN-9371]
== Reaction(s) known to consume the compound ==
+
* [NoneLOGANATE-O-METHYLTRANSFERASE-RXN LOGANATE-O-METHYLTRANSFERASE-RXN]
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* [None1.3.3.9-RXN 1.3.3.9-RXN]
* [[RXN1F-93]]
+
* [NoneRXN-9369 RXN-9369]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-15237 RXN-15237]
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
+
* [NoneRXN-9367 RXN-9367]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-20744 RXN-20744]
{{#set: common-name=(+)-dihydrokaempferol}}
+
* [NoneRXN-20745 RXN-20745]
{{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}}
+
* [NoneRXN-19644 RXN-19644]
{{#set: molecular-weight=288.256}}
+
* [NoneRXN-9372 RXN-9372]
 +
* [NoneRXN-8197 RXN-8197]
 +
* [NoneRXN-4521 RXN-4521]
 +
* [NoneRXN-9368 RXN-9368]
 +
* [NoneRXN-9370 RXN-9370]
 +
{{#set: taxonomic-range=tax-4056|tax-26468|tax-24966}}
 +
{{#set: common-name=secologanin and strictosidine biosynthesis}}
 +
{{#set: nb reaction found=2}}
 +
{{#set: completion rate=0.12}}
 +
{{#set: nb total reaction=17}}

Revision as of 20:17, 18 December 2020

Pathway PWY-5290

  • taxonomic-range:
    • tax-24966
    • tax-26468
    • tax-4056
  • common-name:
    • secologanin and strictosidine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8618 RXN-8618]
  • [NoneRXN-9371 RXN-9371]
  • [NoneLOGANATE-O-METHYLTRANSFERASE-RXN LOGANATE-O-METHYLTRANSFERASE-RXN]
  • [None1.3.3.9-RXN 1.3.3.9-RXN]
  • [NoneRXN-9369 RXN-9369]
  • [NoneRXN-15237 RXN-15237]
  • [NoneRXN-9367 RXN-9367]
  • [NoneRXN-20744 RXN-20744]
  • [NoneRXN-20745 RXN-20745]
  • [NoneRXN-19644 RXN-19644]
  • [NoneRXN-9372 RXN-9372]
  • [NoneRXN-8197 RXN-8197]
  • [NoneRXN-4521 RXN-4521]
  • [NoneRXN-9368 RXN-9368]
  • [NoneRXN-9370 RXN-9370]