Difference between revisions of "PWY-5086"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12706 CPD-12706] == * common-name: ** 5-fluoro-5-deoxy-d-ribose 1-phosphate * smiles: ** c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,4-dihydroxymandelate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rghmisiykihajw-ssdottswsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 183.14 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10912]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxymandelate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.14}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-11879
- common-name:
- 3,4-dihydroxymandelate
- smiles:
- c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
- inchi-key:
- rghmisiykihajw-ssdottswsa-m
- molecular-weight:
- 183.14
