Difference between revisions of "PWY-5086"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] ==
 * common-name:
-** 3,4-dihydroxymandelate
+** androst-4-ene-3,17-dione
 * smiles:
-** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
+** cc34(ccc(=o)c=c(cc[ch]1([ch](ccc2(c)(c(cc[ch]12)=o))3))4)
 * inchi-key:
-** rghmisiykihajw-ssdottswsa-m
+** aemfnilzojdqlw-qaggrknesa-n
 * molecular-weight:
-** 183.14
+** 286.413
 == Reaction(s) known to consume the compound ==
+* [[1.1.1.64-RXN]]
+* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10912]]
+* [[1.1.1.51-RXN]]
+* [[RXN-12124]]
+* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3,4-dihydroxymandelate}}
+{{#set: common-name=androst-4-ene-3,17-dione}}
-{{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}}
+{{#set: inchi-key=inchikey=aemfnilzojdqlw-qaggrknesa-n}}
-{{#set: molecular-weight=183.14}}
+{{#set: molecular-weight=286.413}}