Difference between revisions of "PWY-5101"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == |
* common-name: | * common-name: | ||
− | ** | + | ** dcdp |
* smiles: | * smiles: | ||
− | ** | + | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ftdhdkpuhblbtl-shyzeuofsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 384.155 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ATDCD]] |
+ | * [[ATDCDm]] | ||
+ | * [[DCDPKIN-RXN]] | ||
+ | * [[DCTPtm]] | ||
+ | * [[RXN-14187]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ATDCM]] |
+ | * [[CDPREDUCT-RXN]] | ||
+ | * [[DCDT]] | ||
+ | * [[DCTCP]] | ||
+ | * [[DCTPtm]] | ||
+ | * [[DCTUP]] | ||
+ | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] | ||
+ | * [[RXN-14216]] | ||
+ | * [[RXN-7913]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dcdp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=384.155}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite DCDP
- common-name:
- dcdp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
- inchi-key:
- ftdhdkpuhblbtl-shyzeuofsa-k
- molecular-weight:
- 384.155